41667-95-2 Usage
Uses
Used in Chemical Synthesis:
5,6-Dichloronicotinic acid is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure allows it to be a versatile building block in the creation of new molecules with specific properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5,6-Dichloronicotinic acid is used as a precursor in the synthesis of certain drugs. Its ability to be modified and incorporated into complex molecular structures makes it valuable for the development of new medications with targeted therapeutic effects.
Used in the Preparation of 5-Chloro-6-Iodonicotinic Acid:
5,6-Dichloronicotinic acid is specifically used in the preparation of 5-chloro-6-iodonicotinic acid through a process of iodine displacement. This reaction allows for the creation of a new compound with different properties, which can be further utilized in various applications, such as in the development of radiopharmaceuticals for medical imaging or as potential therapeutic agents.
Overall, 5,6-Dichloronicotinic acid is a valuable compound in the field of organic chemistry, with its uses spanning across different industries, including pharmaceuticals and chemical synthesis. Its versatility and potential for creating new molecules make it an important component in the development of innovative products and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 41667-95-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,6,6 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 41667-95:
(7*4)+(6*1)+(5*6)+(4*6)+(3*7)+(2*9)+(1*5)=132
132 % 10 = 2
So 41667-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)